C18H19N7OS — CID 122349281
4-[6-(pyridin-2-ylamino)pyrimidin-4-yl]-N-thiophen-2-ylpiperazine-1-carboxamide (PubChem CID 122349281) has the molecular formula C18H19N7OS and a molecular weight of 381.47 g/mol. Its IUPAC name is 4-[6-(pyridin-2-ylamino)pyrimidin-4-yl]-N-thiophen-2-ylpiperazine-1-carboxamide.
| Compound Name | 4-[6-(pyridin-2-ylamino)pyrimidin-4-yl]-N-thiophen-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 122349281 |
| Molecular Formula | C18H19N7OS |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 4-[6-(pyridin-2-ylamino)pyrimidin-4-yl]-N-thiophen-2-ylpiperazine-1-carboxamide |
| SMILES | O=C(Nc1cccs1)N1CCN(c2cc(Nc3ccccn3)ncn2)CC1 |
| InChI | InChI=1S/C18H19N7OS/c26-18(23-17-5-3-11-27-17)25-9-7-24(8-10-25)16-12-15(20-13-21-16)22-14-4-1-2-6-19-14/h1-6,11-13H,7-10H2,(H,23,26)(H,19,20,21,22) |
| InChIKey | ROESYRQZCOJXHX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |