C21H19F3N6O — CID 122351437
[4-[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone (PubChem CID 122351437) has the molecular formula C21H19F3N6O and a molecular weight of 428.42 g/mol. Its IUPAC name is [4-[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone.
| Compound Name | [4-[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 122351437 |
| Molecular Formula | C21H19F3N6O |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | [4-[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]piperazin-1-yl]-(2,3,4-trifluorophenyl)methanone |
| SMILES | Cc1ccc(Nc2ccc(N3CCN(C(=O)c4ccc(F)c(F)c4F)CC3)nn2)nc1 |
| InChI | InChI=1S/C21H19F3N6O/c1-13-2-5-16(25-12-13)26-17-6-7-18(28-27-17)29-8-10-30(11-9-29)21(31)14-3-4-15(22)20(24)19(14)23/h2-7,12H,8-11H2,1H3,(H,25,26,27) |
| InChIKey | XHHUPWHTUXRIAS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|