C21H23N7O — CID 56919619
4-[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]-N-phenylpiperazine-1-carboxamide (PubChem CID 56919619) has the molecular formula C21H23N7O and a molecular weight of 389.46 g/mol. Its IUPAC name is 4-[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]-N-phenylpiperazine-1-carboxamide.
| Compound Name | 4-[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]-N-phenylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 56919619 |
| Molecular Formula | C21H23N7O |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 4-[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]-N-phenylpiperazine-1-carboxamide |
| SMILES | Cc1ccc(Nc2ccc(N3CCN(C(=O)Nc4ccccc4)CC3)nn2)nc1 |
| InChI | InChI=1S/C21H23N7O/c1-16-7-8-18(22-15-16)24-19-9-10-20(26-25-19)27-11-13-28(14-12-27)21(29)23-17-5-3-2-4-6-17/h2-10,15H,11-14H2,1H3,(H,23,29)(H,22,24,25) |
| InChIKey | CETHMVJLBWOAGG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |