C12H7ClF3NO — CID 122358477
5-[2-chloro-4-(trifluoromethyl)phenyl]-1H-pyridin-2-one (PubChem CID 122358477) has the molecular formula C12H7ClF3NO and a molecular weight of 273.64 g/mol. Its IUPAC name is 5-[2-chloro-4-(trifluoromethyl)phenyl]-1H-pyridin-2-one.
| Compound Name | 5-[2-chloro-4-(trifluoromethyl)phenyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 122358477 |
| Molecular Formula | C12H7ClF3NO |
| Molecular Weight | 273.64 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 5-[2-chloro-4-(trifluoromethyl)phenyl]-1H-pyridin-2-one |
| SMILES | O=c1ccc(-c2ccc(C(F)(F)F)cc2Cl)c[nH]1 |
| InChI | InChI=1S/C12H7ClF3NO/c13-10-5-8(12(14,15)16)2-3-9(10)7-1-4-11(18)17-6-7/h1-6H,(H,17,18) |
| InChIKey | GXXNSBXDRVZTJY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.64 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |