About 1-aminopent-4-yn-2-ol;hydrochloride
1-aminopent-4-yn-2-ol;hydrochloride (PubChem CID 122360379) has the molecular formula C5H10ClNO
and a molecular weight of 135.59 g/mol. Its IUPAC name is 1-aminopent-4-yn-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 1-aminopent-4-yn-2-ol;hydrochloride |
| PubChem CID | 122360379 |
| Molecular Formula | C5H10ClNO |
| Molecular Weight | 135.59 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | 1-aminopent-4-yn-2-ol;hydrochloride |
| SMILES | C#CCC(O)CN.Cl |
| InChI | InChI=1S/C5H9NO.ClH/c1-2-3-5(7)4-6;/h1,5,7H,3-4,6H2;1H |
| InChIKey | KOANJOXWAJZRFK-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.59 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopent-4-yn-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopent-4-yn-2-ol;hydrochloride?
The IUPAC name of 1-aminopent-4-yn-2-ol;hydrochloride (CID 122360379) is 1-aminopent-4-yn-2-ol;hydrochloride.
What is the SMILES notation for 1-aminopent-4-yn-2-ol;hydrochloride?
The canonical SMILES for 1-aminopent-4-yn-2-ol;hydrochloride is C#CCC(O)CN.Cl.
What is the InChIKey of 1-aminopent-4-yn-2-ol;hydrochloride?
The InChIKey is KOANJOXWAJZRFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.ClH/c1-2-3-5(7)4-6;/h1,5,7H,3-4,6H2;1H.
What are the key properties of 1-aminopent-4-yn-2-ol;hydrochloride?
1-aminopent-4-yn-2-ol;hydrochloride has a molecular weight of 135.59 g/mol, XLogP of -0.25, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopent-4-yn-2-ol;hydrochloride is sourced from PubChem (CID 122360379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).