C19H24FNO3 — CID 122361311
1-[(7R)-7-[(2-fluorophenyl)methyl]-1,4-dioxa-8-azaspiro[4.5]decan-8-yl]pent-4-en-1-one (PubChem CID 122361311) has the molecular formula C19H24FNO3 and a molecular weight of 333.40 g/mol. Its IUPAC name is 1-[(7R)-7-[(2-fluorophenyl)methyl]-1,4-dioxa-8-azaspiro[4.5]decan-8-yl]pent-4-en-1-one.
| Compound Name | 1-[(7R)-7-[(2-fluorophenyl)methyl]-1,4-dioxa-8-azaspiro[4.5]decan-8-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 122361311 |
| Molecular Formula | C19H24FNO3 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 1-[(7R)-7-[(2-fluorophenyl)methyl]-1,4-dioxa-8-azaspiro[4.5]decan-8-yl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)N1CCC2(C[C@H]1Cc1ccccc1F)OCCO2 |
| InChI | InChI=1S/C19H24FNO3/c1-2-3-8-18(22)21-10-9-19(23-11-12-24-19)14-16(21)13-15-6-4-5-7-17(15)20/h2,4-7,16H,1,3,8-14H2/t16-/m1/s1 |
| InChIKey | DRYFKFRMHJCADL-MRXNPFEDSA-N |
| XLogP | 3.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|