C30H33N3O4 — CID 122362395
(19S)-8-amino-7-[(2E)-3,7-dimethylocta-2,6-dienyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione (PubChem CID 122362395) has the molecular formula C30H33N3O4 and a molecular weight of 499.61 g/mol. Its IUPAC name is (19S)-8-amino-7-[(2E)-3,7-dimethylocta-2,6-dienyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-8-amino-7-[(2E)-3,7-dimethylocta-2,6-dienyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 122362395 |
| Molecular Formula | C30H33N3O4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | (19S)-8-amino-7-[(2E)-3,7-dimethylocta-2,6-dienyl]-19-ethyl-19-hydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3c(N)c(C/C=C(\C)CCC=C(C)C)ccc3nc2-1 |
| InChI | InChI=1S/C30H33N3O4/c1-5-30(36)23-14-25-27-20(15-33(25)28(34)22(23)16-37-29(30)35)13-21-24(32-27)12-11-19(26(21)31)10-9-18(4)8-6-7-17(2)3/h7,9,11-14,36H,5-6,8,10,15-16,31H2,1-4H3/b18-9+/t30-/m0/s1 |
| InChIKey | ZMHSOIDLATXHAM-PJYBQQLWSA-N |
| XLogP | 4.90 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|