C21H22N2O2 — CID 122363330
2-(4-methoxyphenyl)imino-2-phenyl-N,N-bis(prop-2-enyl)acetamide (PubChem CID 122363330) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)imino-2-phenyl-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-(4-methoxyphenyl)imino-2-phenyl-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 122363330 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 2-(4-methoxyphenyl)imino-2-phenyl-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)/C(=N\c1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O2/c1-4-15-23(16-5-2)21(24)20(17-9-7-6-8-10-17)22-18-11-13-19(25-3)14-12-18/h4-14H,1-2,15-16H2,3H3/b22-20- |
| InChIKey | WHMJSNZVHHYWSQ-XDOYNYLZSA-N |
| XLogP | 4.02 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|