C14H18O4S — CID 122363976
(4S,5S)-2,2,5-trimethyl-4-(4-methylphenyl)sulfonyloxolan-3-one (PubChem CID 122363976) has the molecular formula C14H18O4S and a molecular weight of 282.36 g/mol. Its IUPAC name is (4S,5S)-2,2,5-trimethyl-4-(4-methylphenyl)sulfonyloxolan-3-one.
| Compound Name | (4S,5S)-2,2,5-trimethyl-4-(4-methylphenyl)sulfonyloxolan-3-one |
|---|---|
| PubChem CID | 122363976 |
| Molecular Formula | C14H18O4S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (4S,5S)-2,2,5-trimethyl-4-(4-methylphenyl)sulfonyloxolan-3-one |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2C(=O)C(C)(C)O[C@H]2C)cc1 |
| InChI | InChI=1S/C14H18O4S/c1-9-5-7-11(8-6-9)19(16,17)12-10(2)18-14(3,4)13(12)15/h5-8,10,12H,1-4H3/t10-,12-/m0/s1 |
| InChIKey | RFOZAONIZRAVON-JQWIXIFHSA-N |
| XLogP | 1.90 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |