C19H13Cl2N3 — CID 122364244
5,7-bis(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidine (PubChem CID 122364244) has the molecular formula C19H13Cl2N3 and a molecular weight of 354.24 g/mol. Its IUPAC name is 5,7-bis(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidine.
| Compound Name | 5,7-bis(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 122364244 |
| Molecular Formula | C19H13Cl2N3 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 5,7-bis(4-chlorophenyl)-2-methylpyrazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc2nc(-c3ccc(Cl)cc3)cc(-c3ccc(Cl)cc3)n2n1 |
| InChI | InChI=1S/C19H13Cl2N3/c1-12-10-19-22-17(13-2-6-15(20)7-3-13)11-18(24(19)23-12)14-4-8-16(21)9-5-14/h2-11H,1H3 |
| InChIKey | VDTOEHWETPLTBF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |