C21H26O4S — CID 122364274
(5,5-dimethyl-4-oxo-1-phenylhexan-3-yl) 4-methylbenzenesulfonate (PubChem CID 122364274) has the molecular formula C21H26O4S and a molecular weight of 374.50 g/mol. Its IUPAC name is (5,5-dimethyl-4-oxo-1-phenylhexan-3-yl) 4-methylbenzenesulfonate.
| Compound Name | (5,5-dimethyl-4-oxo-1-phenylhexan-3-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 122364274 |
| Molecular Formula | C21H26O4S |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (5,5-dimethyl-4-oxo-1-phenylhexan-3-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(CCc2ccccc2)C(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H26O4S/c1-16-10-13-18(14-11-16)26(23,24)25-19(20(22)21(2,3)4)15-12-17-8-6-5-7-9-17/h5-11,13-14,19H,12,15H2,1-4H3 |
| InChIKey | RHLZSQWHXFOXOG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|