C29H28F3NO4 — CID 122365680
(5E)-7,8-dimethoxy-3-[(4-methoxyphenyl)methyl]-5-[1-[3-(trifluoromethyl)phenyl]ethylidene]-1,2-dihydro-3-benzazepin-4-one (PubChem CID 122365680) has the molecular formula C29H28F3NO4 and a molecular weight of 511.54 g/mol. Its IUPAC name is (5E)-7,8-dimethoxy-3-[(4-methoxyphenyl)methyl]-5-[1-[3-(trifluoromethyl)phenyl]ethylidene]-1,2-dihydro-3-benzazepin-4-one.
| Compound Name | (5E)-7,8-dimethoxy-3-[(4-methoxyphenyl)methyl]-5-[1-[3-(trifluoromethyl)phenyl]ethylidene]-1,2-dihydro-3-benzazepin-4-one |
|---|---|
| PubChem CID | 122365680 |
| Molecular Formula | C29H28F3NO4 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | (5E)-7,8-dimethoxy-3-[(4-methoxyphenyl)methyl]-5-[1-[3-(trifluoromethyl)phenyl]ethylidene]-1,2-dihydro-3-benzazepin-4-one |
| SMILES | COc1ccc(CN2CCc3cc(OC)c(OC)cc3/C(=C(/C)c3cccc(C(F)(F)F)c3)C2=O)cc1 |
| InChI | InChI=1S/C29H28F3NO4/c1-18(20-6-5-7-22(14-20)29(30,31)32)27-24-16-26(37-4)25(36-3)15-21(24)12-13-33(28(27)34)17-19-8-10-23(35-2)11-9-19/h5-11,14-16H,12-13,17H2,1-4H3/b27-18+ |
| InChIKey | FAGKPQFRWJWIAE-OVVQPSECSA-N |
| XLogP | 6.25 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|