About (4-fluorophenyl)methyl 2-[(2-pyridin-2-ylacetyl)amino]benzoate
(4-fluorophenyl)methyl 2-[(2-pyridin-2-ylacetyl)amino]benzoate (PubChem CID 122367483) has the molecular formula C21H17FN2O3
and a molecular weight of 364.38 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 2-[(2-pyridin-2-ylacetyl)amino]benzoate.
Molecular Properties
| Compound Name | (4-fluorophenyl)methyl 2-[(2-pyridin-2-ylacetyl)amino]benzoate |
| PubChem CID | 122367483 |
| Molecular Formula | C21H17FN2O3 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (4-fluorophenyl)methyl 2-[(2-pyridin-2-ylacetyl)amino]benzoate |
| SMILES | O=C(Cc1ccccn1)Nc1ccccc1C(=O)OCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H17FN2O3/c22-16-10-8-15(9-11-16)14-27-21(26)18-6-1-2-7-19(18)24-20(25)13-17-5-3-4-12-23-17/h1-12H,13-14H2,(H,24,25) |
| InChIKey | HDSZFXPDRLEWDF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-fluorophenyl)methyl 2-[(2-pyridin-2-ylacetyl)amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)methyl 2-[(2-pyridin-2-ylacetyl)amino]benzoate?
The IUPAC name of (4-fluorophenyl)methyl 2-[(2-pyridin-2-ylacetyl)amino]benzoate (CID 122367483) is (4-fluorophenyl)methyl 2-[(2-pyridin-2-ylacetyl)amino]benzoate.
What is the SMILES notation for (4-fluorophenyl)methyl 2-[(2-pyridin-2-ylacetyl)amino]benzoate?
The canonical SMILES for (4-fluorophenyl)methyl 2-[(2-pyridin-2-ylacetyl)amino]benzoate is O=C(Cc1ccccn1)Nc1ccccc1C(=O)OCc1ccc(F)cc1.
What is the InChIKey of (4-fluorophenyl)methyl 2-[(2-pyridin-2-ylacetyl)amino]benzoate?
The InChIKey is HDSZFXPDRLEWDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17FN2O3/c22-16-10-8-15(9-11-16)14-27-21(26)18-6-1-2-7-19(18)24-20(25)13-17-5-3-4-12-23-17/h1-12H,13-14H2,(H,24,25).
What are the key properties of (4-fluorophenyl)methyl 2-[(2-pyridin-2-ylacetyl)amino]benzoate?
(4-fluorophenyl)methyl 2-[(2-pyridin-2-ylacetyl)amino]benzoate has a molecular weight of 364.38 g/mol, XLogP of 3.76, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)methyl 2-[(2-pyridin-2-ylacetyl)amino]benzoate is sourced from PubChem (CID 122367483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).