C14H18N2O4 — CID 122368109
[2-(morpholine-4-carbonyl)phenyl] N,N-dimethylcarbamate (PubChem CID 122368109) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is [2-(morpholine-4-carbonyl)phenyl] N,N-dimethylcarbamate.
| Compound Name | [2-(morpholine-4-carbonyl)phenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 122368109 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [2-(morpholine-4-carbonyl)phenyl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1ccccc1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H18N2O4/c1-15(2)14(18)20-12-6-4-3-5-11(12)13(17)16-7-9-19-10-8-16/h3-6H,7-10H2,1-2H3 |
| InChIKey | QNQYQXLGPWCPIG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |