C13H12ClNO — CID 122368732
(4-chlorophenyl)-(3,5-dimethyl-1H-pyrrol-2-yl)methanone (PubChem CID 122368732) has the molecular formula C13H12ClNO and a molecular weight of 233.70 g/mol. Its IUPAC name is (4-chlorophenyl)-(3,5-dimethyl-1H-pyrrol-2-yl)methanone.
| Compound Name | (4-chlorophenyl)-(3,5-dimethyl-1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 122368732 |
| Molecular Formula | C13H12ClNO |
| Molecular Weight | 233.70 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | (4-chlorophenyl)-(3,5-dimethyl-1H-pyrrol-2-yl)methanone |
| SMILES | Cc1cc(C)c(C(=O)c2ccc(Cl)cc2)[nH]1 |
| InChI | InChI=1S/C13H12ClNO/c1-8-7-9(2)15-12(8)13(16)10-3-5-11(14)6-4-10/h3-7,15H,1-2H3 |
| InChIKey | KRRQLNRZNZYWKV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.70 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |