C15H20O5 — CID 122368755
diethyl (5S,6S)-6-hydroxy-5-prop-2-enylcyclohexa-1,3-diene-1,2-dicarboxylate (PubChem CID 122368755) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is diethyl (5S,6S)-6-hydroxy-5-prop-2-enylcyclohexa-1,3-diene-1,2-dicarboxylate.
| Compound Name | diethyl (5S,6S)-6-hydroxy-5-prop-2-enylcyclohexa-1,3-diene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 122368755 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | diethyl (5S,6S)-6-hydroxy-5-prop-2-enylcyclohexa-1,3-diene-1,2-dicarboxylate |
| SMILES | C=CC[C@H]1C=CC(C(=O)OCC)=C(C(=O)OCC)[C@H]1O |
| InChI | InChI=1S/C15H20O5/c1-4-7-10-8-9-11(14(17)19-5-2)12(13(10)16)15(18)20-6-3/h4,8-10,13,16H,1,5-7H2,2-3H3/t10-,13-/m0/s1 |
| InChIKey | PGNXTENIFLBELC-GWCFXTLKSA-N |
| XLogP | 1.53 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|