C32H29NO — CID 122370320
1-benzyl-5-[[(2S)-5,5-diphenyloxolan-2-yl]methyl]indole (PubChem CID 122370320) has the molecular formula C32H29NO and a molecular weight of 443.59 g/mol. Its IUPAC name is 1-benzyl-5-[[(2S)-5,5-diphenyloxolan-2-yl]methyl]indole.
| Compound Name | 1-benzyl-5-[[(2S)-5,5-diphenyloxolan-2-yl]methyl]indole |
|---|---|
| PubChem CID | 122370320 |
| Molecular Formula | C32H29NO |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 1-benzyl-5-[[(2S)-5,5-diphenyloxolan-2-yl]methyl]indole |
| SMILES | c1ccc(Cn2ccc3cc(C[C@@H]4CCC(c5ccccc5)(c5ccccc5)O4)ccc32)cc1 |
| InChI | InChI=1S/C32H29NO/c1-4-10-25(11-5-1)24-33-21-19-27-22-26(16-17-31(27)33)23-30-18-20-32(34-30,28-12-6-2-7-13-28)29-14-8-3-9-15-29/h1-17,19,21-22,30H,18,20,23-24H2/t30-/m0/s1 |
| InChIKey | KOUVDQZAUBTRFP-PMERELPUSA-N |
| XLogP | 7.35 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |