C22H43O10P — CID 122371171
[1-hydroxy-3-[hydroxy-(3-hydroxy-2-octanoyloxypropoxy)phosphoryl]oxypropan-2-yl] octanoate (PubChem CID 122371171) has the molecular formula C22H43O10P and a molecular weight of 498.55 g/mol. Its IUPAC name is [1-hydroxy-3-[hydroxy-(3-hydroxy-2-octanoyloxypropoxy)phosphoryl]oxypropan-2-yl] octanoate.
| Compound Name | [1-hydroxy-3-[hydroxy-(3-hydroxy-2-octanoyloxypropoxy)phosphoryl]oxypropan-2-yl] octanoate |
|---|---|
| PubChem CID | 122371171 |
| Molecular Formula | C22H43O10P |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | [1-hydroxy-3-[hydroxy-(3-hydroxy-2-octanoyloxypropoxy)phosphoryl]oxypropan-2-yl] octanoate |
| SMILES | CCCCCCCC(=O)OC(CO)COP(=O)(O)OCC(CO)OC(=O)CCCCCCC |
| InChI | InChI=1S/C22H43O10P/c1-3-5-7-9-11-13-21(25)31-19(15-23)17-29-33(27,28)30-18-20(16-24)32-22(26)14-12-10-8-6-4-2/h19-20,23-24H,3-18H2,1-2H3,(H,27,28) |
| InChIKey | SJQOGOIVIUSDAS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|