C19H37O10P — CID 138149022
[1-hydroxy-3-[hydroxy-(3-hydroxy-2-pentanoyloxypropoxy)phosphoryl]oxypropan-2-yl] octanoate (PubChem CID 138149022) has the molecular formula C19H37O10P and a molecular weight of 456.47 g/mol. Its IUPAC name is [1-hydroxy-3-[hydroxy-(3-hydroxy-2-pentanoyloxypropoxy)phosphoryl]oxypropan-2-yl] octanoate.
| Compound Name | [1-hydroxy-3-[hydroxy-(3-hydroxy-2-pentanoyloxypropoxy)phosphoryl]oxypropan-2-yl] octanoate |
|---|---|
| PubChem CID | 138149022 |
| Molecular Formula | C19H37O10P |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | [1-hydroxy-3-[hydroxy-(3-hydroxy-2-pentanoyloxypropoxy)phosphoryl]oxypropan-2-yl] octanoate |
| SMILES | CCCCCCCC(=O)OC(CO)COP(=O)(O)OCC(CO)OC(=O)CCCC |
| InChI | InChI=1S/C19H37O10P/c1-3-5-7-8-9-11-19(23)29-17(13-21)15-27-30(24,25)26-14-16(12-20)28-18(22)10-6-4-2/h16-17,20-21H,3-15H2,1-2H3,(H,24,25) |
| InChIKey | DYYSEBCEQGEXLG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|