C21H25BrClNO2 — CID 122371286
methyl 2-(4-bromophenyl)-1-(5-chloropentyl)-4,5,6,7-tetrahydroindole-3-carboxylate (PubChem CID 122371286) has the molecular formula C21H25BrClNO2 and a molecular weight of 438.79 g/mol. Its IUPAC name is methyl 2-(4-bromophenyl)-1-(5-chloropentyl)-4,5,6,7-tetrahydroindole-3-carboxylate.
| Compound Name | methyl 2-(4-bromophenyl)-1-(5-chloropentyl)-4,5,6,7-tetrahydroindole-3-carboxylate |
|---|---|
| PubChem CID | 122371286 |
| Molecular Formula | C21H25BrClNO2 |
| Molecular Weight | 438.79 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | methyl 2-(4-bromophenyl)-1-(5-chloropentyl)-4,5,6,7-tetrahydroindole-3-carboxylate |
| SMILES | COC(=O)c1c2c(n(CCCCCCl)c1-c1ccc(Br)cc1)CCCC2 |
| InChI | InChI=1S/C21H25BrClNO2/c1-26-21(25)19-17-7-3-4-8-18(17)24(14-6-2-5-13-23)20(19)15-9-11-16(22)12-10-15/h9-12H,2-8,13-14H2,1H3 |
| InChIKey | SCAXDCVIBUZAHU-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.79 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|