C24H17N5O3S — CID 122371363
12-amino-1'-benzyl-2',8-dioxospiro[13-oxa-4-thia-2,7-diazatricyclo[7.4.0.03,7]trideca-1(9),2,11-triene-10,3'-indole]-11-carbonitrile (PubChem CID 122371363) has the molecular formula C24H17N5O3S and a molecular weight of 455.50 g/mol. Its IUPAC name is 12-amino-1'-benzyl-2',8-dioxospiro[13-oxa-4-thia-2,7-diazatricyclo[7.4.0.03,7]trideca-1(9),2,11-triene-10,3'-indole]-11-carbonitrile.
| Compound Name | 12-amino-1'-benzyl-2',8-dioxospiro[13-oxa-4-thia-2,7-diazatricyclo[7.4.0.03,7]trideca-1(9),2,11-triene-10,3'-indole]-11-carbonitrile |
|---|---|
| PubChem CID | 122371363 |
| Molecular Formula | C24H17N5O3S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 12-amino-1'-benzyl-2',8-dioxospiro[13-oxa-4-thia-2,7-diazatricyclo[7.4.0.03,7]trideca-1(9),2,11-triene-10,3'-indole]-11-carbonitrile |
| SMILES | N#CC1=C(N)Oc2nc3n(c(=O)c2C12C(=O)N(Cc1ccccc1)c1ccccc12)CCS3 |
| InChI | InChI=1S/C24H17N5O3S/c25-12-16-19(26)32-20-18(21(30)28-10-11-33-23(28)27-20)24(16)15-8-4-5-9-17(15)29(22(24)31)13-14-6-2-1-3-7-14/h1-9H,10-11,13,26H2 |
| InChIKey | XZILZAKTYFQFNN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |