C18H12N6O5S — CID 122371369
12-amino-1'-methyl-5'-nitro-2',8-dioxospiro[13-oxa-4-thia-2,7-diazatricyclo[7.4.0.03,7]trideca-1(9),2,11-triene-10,3'-indole]-11-carbonitrile (PubChem CID 122371369) has the molecular formula C18H12N6O5S and a molecular weight of 424.40 g/mol. Its IUPAC name is 12-amino-1'-methyl-5'-nitro-2',8-dioxospiro[13-oxa-4-thia-2,7-diazatricyclo[7.4.0.03,7]trideca-1(9),2,11-triene-10,3'-indole]-11-carbonitrile.
| Compound Name | 12-amino-1'-methyl-5'-nitro-2',8-dioxospiro[13-oxa-4-thia-2,7-diazatricyclo[7.4.0.03,7]trideca-1(9),2,11-triene-10,3'-indole]-11-carbonitrile |
|---|---|
| PubChem CID | 122371369 |
| Molecular Formula | C18H12N6O5S |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 12-amino-1'-methyl-5'-nitro-2',8-dioxospiro[13-oxa-4-thia-2,7-diazatricyclo[7.4.0.03,7]trideca-1(9),2,11-triene-10,3'-indole]-11-carbonitrile |
| SMILES | CN1C(=O)C2(C(C#N)=C(N)Oc3nc4n(c(=O)c32)CCS4)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C18H12N6O5S/c1-22-11-3-2-8(24(27)28)6-9(11)18(16(22)26)10(7-19)13(20)29-14-12(18)15(25)23-4-5-30-17(23)21-14/h2-3,6H,4-5,20H2,1H3 |
| InChIKey | FMCQUNSKJRFGAH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 157.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|