About 2-[2-(2,4-dimethylphenyl)phenyl]-1-ethyl-N-methylbenzimidazole-5-carboxamide
2-[2-(2,4-dimethylphenyl)phenyl]-1-ethyl-N-methylbenzimidazole-5-carboxamide (PubChem CID 122371996) has the molecular formula C25H25N3O
and a molecular weight of 383.50 g/mol. Its IUPAC name is 2-[2-(2,4-dimethylphenyl)phenyl]-1-ethyl-N-methylbenzimidazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-[2-(2,4-dimethylphenyl)phenyl]-1-ethyl-N-methylbenzimidazole-5-carboxamide |
| PubChem CID | 122371996 |
| Molecular Formula | C25H25N3O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 2-[2-(2,4-dimethylphenyl)phenyl]-1-ethyl-N-methylbenzimidazole-5-carboxamide |
| SMILES | CCn1c(-c2ccccc2-c2ccc(C)cc2C)nc2cc(C(=O)NC)ccc21 |
| InChI | InChI=1S/C25H25N3O/c1-5-28-23-13-11-18(25(29)26-4)15-22(23)27-24(28)21-9-7-6-8-20(21)19-12-10-16(2)14-17(19)3/h6-15H,5H2,1-4H3,(H,26,29) |
| InChIKey | AAUYSFKQQJKKDD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(2,4-dimethylphenyl)phenyl]-1-ethyl-N-methylbenzimidazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,4-dimethylphenyl)phenyl]-1-ethyl-N-methylbenzimidazole-5-carboxamide?
The IUPAC name of 2-[2-(2,4-dimethylphenyl)phenyl]-1-ethyl-N-methylbenzimidazole-5-carboxamide (CID 122371996) is 2-[2-(2,4-dimethylphenyl)phenyl]-1-ethyl-N-methylbenzimidazole-5-carboxamide.
What is the SMILES notation for 2-[2-(2,4-dimethylphenyl)phenyl]-1-ethyl-N-methylbenzimidazole-5-carboxamide?
The canonical SMILES for 2-[2-(2,4-dimethylphenyl)phenyl]-1-ethyl-N-methylbenzimidazole-5-carboxamide is CCn1c(-c2ccccc2-c2ccc(C)cc2C)nc2cc(C(=O)NC)ccc21.
What is the InChIKey of 2-[2-(2,4-dimethylphenyl)phenyl]-1-ethyl-N-methylbenzimidazole-5-carboxamide?
The InChIKey is AAUYSFKQQJKKDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25N3O/c1-5-28-23-13-11-18(25(29)26-4)15-22(23)27-24(28)21-9-7-6-8-20(21)19-12-10-16(2)14-17(19)3/h6-15H,5H2,1-4H3,(H,26,29).
What are the key properties of 2-[2-(2,4-dimethylphenyl)phenyl]-1-ethyl-N-methylbenzimidazole-5-carboxamide?
2-[2-(2,4-dimethylphenyl)phenyl]-1-ethyl-N-methylbenzimidazole-5-carboxamide has a molecular weight of 383.50 g/mol, XLogP of 5.37, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,4-dimethylphenyl)phenyl]-1-ethyl-N-methylbenzimidazole-5-carboxamide is sourced from PubChem (CID 122371996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).