C23H23N3O2S — CID 176978723
2-[2-(2,4-dimethylphenyl)phenyl]-1-ethylbenzimidazole-5-sulfonamide (PubChem CID 176978723) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-[2-(2,4-dimethylphenyl)phenyl]-1-ethylbenzimidazole-5-sulfonamide.
| Compound Name | 2-[2-(2,4-dimethylphenyl)phenyl]-1-ethylbenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 176978723 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-[2-(2,4-dimethylphenyl)phenyl]-1-ethylbenzimidazole-5-sulfonamide |
| SMILES | CCn1c(-c2ccccc2-c2ccc(C)cc2C)nc2cc(S(N)(=O)=O)ccc21 |
| InChI | InChI=1S/C23H23N3O2S/c1-4-26-22-12-10-17(29(24,27)28)14-21(22)25-23(26)20-8-6-5-7-19(20)18-11-9-15(2)13-16(18)3/h5-14H,4H2,1-3H3,(H2,24,27,28) |
| InChIKey | MHDKEOIADVHGCK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |