C19H21NO4S — CID 122372451
(2S)-2-acetamido-3-[(4-methoxyphenyl)methylsulfanyl]-3-phenylpropanoic acid (PubChem CID 122372451) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is (2S)-2-acetamido-3-[(4-methoxyphenyl)methylsulfanyl]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-acetamido-3-[(4-methoxyphenyl)methylsulfanyl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 122372451 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (2S)-2-acetamido-3-[(4-methoxyphenyl)methylsulfanyl]-3-phenylpropanoic acid |
| SMILES | COc1ccc(CSC(c2ccccc2)[C@@H](NC(C)=O)C(=O)O)cc1 |
| InChI | InChI=1S/C19H21NO4S/c1-13(21)20-17(19(22)23)18(15-6-4-3-5-7-15)25-12-14-8-10-16(24-2)11-9-14/h3-11,17-18H,12H2,1-2H3,(H,20,21)(H,22,23)/t17-,18?/m1/s1 |
| InChIKey | FYEIKLWUSAPEMS-QNSVNVJESA-N |
| XLogP | 3.26 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |