C26H27NO6S2 — CID 87446616
(E)-4-[(4-methoxyphenyl)methylsulfanyl]-4-phenyl-3-(phenylmethoxycarbonylamino)but-1-ene-1-sulfonic acid (PubChem CID 87446616) has the molecular formula C26H27NO6S2 and a molecular weight of 513.64 g/mol. Its IUPAC name is (E)-4-[(4-methoxyphenyl)methylsulfanyl]-4-phenyl-3-(phenylmethoxycarbonylamino)but-1-ene-1-sulfonic acid.
| Compound Name | (E)-4-[(4-methoxyphenyl)methylsulfanyl]-4-phenyl-3-(phenylmethoxycarbonylamino)but-1-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 87446616 |
| Molecular Formula | C26H27NO6S2 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | (E)-4-[(4-methoxyphenyl)methylsulfanyl]-4-phenyl-3-(phenylmethoxycarbonylamino)but-1-ene-1-sulfonic acid |
| SMILES | COc1ccc(CSC(c2ccccc2)C(/C=C/S(=O)(=O)O)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H27NO6S2/c1-32-23-14-12-21(13-15-23)19-34-25(22-10-6-3-7-11-22)24(16-17-35(29,30)31)27-26(28)33-18-20-8-4-2-5-9-20/h2-17,24-25H,18-19H2,1H3,(H,27,28)(H,29,30,31)/b17-16+ |
| InChIKey | URDWPXFLJGHKTQ-WUKNDPDISA-N |
| XLogP | 5.37 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|