C29H33NO7S2 — CID 87445104
(E)-6-(4-methoxyphenyl)-4-[(4-methoxyphenyl)methylsulfanyl]-3-(phenylmethoxycarbonylamino)hex-1-ene-1-sulfonic acid (PubChem CID 87445104) has the molecular formula C29H33NO7S2 and a molecular weight of 571.72 g/mol. Its IUPAC name is (E)-6-(4-methoxyphenyl)-4-[(4-methoxyphenyl)methylsulfanyl]-3-(phenylmethoxycarbonylamino)hex-1-ene-1-sulfonic acid.
| Compound Name | (E)-6-(4-methoxyphenyl)-4-[(4-methoxyphenyl)methylsulfanyl]-3-(phenylmethoxycarbonylamino)hex-1-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 87445104 |
| Molecular Formula | C29H33NO7S2 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | (E)-6-(4-methoxyphenyl)-4-[(4-methoxyphenyl)methylsulfanyl]-3-(phenylmethoxycarbonylamino)hex-1-ene-1-sulfonic acid |
| SMILES | COc1ccc(CCC(SCc2ccc(OC)cc2)C(/C=C/S(=O)(=O)O)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H33NO7S2/c1-35-25-13-8-22(9-14-25)12-17-28(38-21-24-10-15-26(36-2)16-11-24)27(18-19-39(32,33)34)30-29(31)37-20-23-6-4-3-5-7-23/h3-11,13-16,18-19,27-28H,12,17,20-21H2,1-2H3,(H,30,31)(H,32,33,34)/b19-18+ |
| InChIKey | MEDQXSZGOYOYIV-VHEBQXMUSA-N |
| XLogP | 5.63 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|