C24H34O4S2 — CID 58706123
2,2-dimethylpropyl (2R,3R)-3-[(4-methoxyphenyl)methylsulfanyl]-5-phenylpentane-2-sulfonate (PubChem CID 58706123) has the molecular formula C24H34O4S2 and a molecular weight of 450.67 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2R,3R)-3-[(4-methoxyphenyl)methylsulfanyl]-5-phenylpentane-2-sulfonate.
| Compound Name | 2,2-dimethylpropyl (2R,3R)-3-[(4-methoxyphenyl)methylsulfanyl]-5-phenylpentane-2-sulfonate |
|---|---|
| PubChem CID | 58706123 |
| Molecular Formula | C24H34O4S2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 2,2-dimethylpropyl (2R,3R)-3-[(4-methoxyphenyl)methylsulfanyl]-5-phenylpentane-2-sulfonate |
| SMILES | COc1ccc(CS[C@H](CCc2ccccc2)[C@@H](C)S(=O)(=O)OCC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H34O4S2/c1-19(30(25,26)28-18-24(2,3)4)23(16-13-20-9-7-6-8-10-20)29-17-21-11-14-22(27-5)15-12-21/h6-12,14-15,19,23H,13,16-18H2,1-5H3/t19-,23-/m1/s1 |
| InChIKey | SVTFPGNWVCXBAG-AUSIDOKSSA-N |
| XLogP | 5.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|