C24H30N2O7S — CID 11145404
(2R,3R)-6-[methoxy(methyl)amino]-2-[(4-methoxyphenyl)methylsulfanyl]-6-oxo-3-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 11145404) has the molecular formula C24H30N2O7S and a molecular weight of 490.58 g/mol. Its IUPAC name is (2R,3R)-6-[methoxy(methyl)amino]-2-[(4-methoxyphenyl)methylsulfanyl]-6-oxo-3-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (2R,3R)-6-[methoxy(methyl)amino]-2-[(4-methoxyphenyl)methylsulfanyl]-6-oxo-3-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 11145404 |
| Molecular Formula | C24H30N2O7S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | (2R,3R)-6-[methoxy(methyl)amino]-2-[(4-methoxyphenyl)methylsulfanyl]-6-oxo-3-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | COc1ccc(CS[C@@H](C(=O)O)[C@@H](CCC(=O)N(C)OC)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H30N2O7S/c1-26(32-3)21(27)14-13-20(25-24(30)33-15-17-7-5-4-6-8-17)22(23(28)29)34-16-18-9-11-19(31-2)12-10-18/h4-12,20,22H,13-16H2,1-3H3,(H,25,30)(H,28,29)/t20-,22-/m1/s1 |
| InChIKey | FDWDVTROZVTIAZ-IFMALSPDSA-N |
| XLogP | 3.48 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|