C20H18O5 — CID 122373393
ethyl 2-benzyl-4-hydroxy-5-oxo-3-phenylfuran-2-carboxylate (PubChem CID 122373393) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is ethyl 2-benzyl-4-hydroxy-5-oxo-3-phenylfuran-2-carboxylate.
| Compound Name | ethyl 2-benzyl-4-hydroxy-5-oxo-3-phenylfuran-2-carboxylate |
|---|---|
| PubChem CID | 122373393 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | ethyl 2-benzyl-4-hydroxy-5-oxo-3-phenylfuran-2-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccccc2)OC(=O)C(O)=C1c1ccccc1 |
| InChI | InChI=1S/C20H18O5/c1-2-24-19(23)20(13-14-9-5-3-6-10-14)16(17(21)18(22)25-20)15-11-7-4-8-12-15/h3-12,21H,2,13H2,1H3 |
| InChIKey | RKSXNLUALPVGEZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |