C41H47N3O3 — CID 122374457
N-[1,1-bis(1-ethyl-2-methylindol-3-yl)-3-oxo-2-benzofuran-5-yl]undec-10-enamide (PubChem CID 122374457) has the molecular formula C41H47N3O3 and a molecular weight of 629.84 g/mol. Its IUPAC name is N-[1,1-bis(1-ethyl-2-methylindol-3-yl)-3-oxo-2-benzofuran-5-yl]undec-10-enamide.
| Compound Name | N-[1,1-bis(1-ethyl-2-methylindol-3-yl)-3-oxo-2-benzofuran-5-yl]undec-10-enamide |
|---|---|
| PubChem CID | 122374457 |
| Molecular Formula | C41H47N3O3 |
| Molecular Weight | 629.84 g/mol |
| Exact Mass | 629.36 |
| IUPAC Name | N-[1,1-bis(1-ethyl-2-methylindol-3-yl)-3-oxo-2-benzofuran-5-yl]undec-10-enamide |
| SMILES | C=CCCCCCCCCC(=O)Nc1ccc2c(c1)C(=O)OC2(c1c(C)n(CC)c2ccccc12)c1c(C)n(CC)c2ccccc12 |
| InChI | InChI=1S/C41H47N3O3/c1-6-9-10-11-12-13-14-15-24-37(45)42-30-25-26-34-33(27-30)40(46)47-41(34,38-28(4)43(7-2)35-22-18-16-20-31(35)38)39-29(5)44(8-3)36-23-19-17-21-32(36)39/h6,16-23,25-27H,1,7-15,24H2,2-5H3,(H,42,45) |
| InChIKey | STAQFVHJZYJLIT-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.84 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|