C43H44N2O — CID 122374779
2,7-bis[4-[(4-pentylphenyl)iminomethyl]phenyl]cyclohepta-2,4,6-trien-1-one (PubChem CID 122374779) has the molecular formula C43H44N2O and a molecular weight of 604.84 g/mol. Its IUPAC name is 2,7-bis[4-[(4-pentylphenyl)iminomethyl]phenyl]cyclohepta-2,4,6-trien-1-one.
| Compound Name | 2,7-bis[4-[(4-pentylphenyl)iminomethyl]phenyl]cyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 122374779 |
| Molecular Formula | C43H44N2O |
| Molecular Weight | 604.84 g/mol |
| Exact Mass | 604.35 |
| IUPAC Name | 2,7-bis[4-[(4-pentylphenyl)iminomethyl]phenyl]cyclohepta-2,4,6-trien-1-one |
| SMILES | CCCCCc1ccc(/N=C/c2ccc(-c3ccccc(-c4ccc(/C=N/c5ccc(CCCCC)cc5)cc4)c3=O)cc2)cc1 |
| InChI | InChI=1S/C43H44N2O/c1-3-5-7-11-33-19-27-39(28-20-33)44-31-35-15-23-37(24-16-35)41-13-9-10-14-42(43(41)46)38-25-17-36(18-26-38)32-45-40-29-21-34(22-30-40)12-8-6-4-2/h9-10,13-32H,3-8,11-12H2,1-2H3/b44-31+,45-32+ |
| InChIKey | GLMLSOKPYLMTAI-WEXQKQNBSA-N |
| XLogP | 11.35 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.84 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|