C35H29F6N3OS2 — CID 122375468
2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4-(8,8,9,9,10,10-hexafluoro-1,2,14-trimethyl-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl)phenol (PubChem CID 122375468) has the molecular formula C35H29F6N3OS2 and a molecular weight of 685.76 g/mol. Its IUPAC name is 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4-(8,8,9,9,10,10-hexafluoro-1,2,14-trimethyl-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl)phenol.
| Compound Name | 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4-(8,8,9,9,10,10-hexafluoro-1,2,14-trimethyl-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl)phenol |
|---|---|
| PubChem CID | 122375468 |
| Molecular Formula | C35H29F6N3OS2 |
| Molecular Weight | 685.76 g/mol |
| Exact Mass | 685.17 |
| IUPAC Name | 2-[[bis(pyridin-2-ylmethyl)amino]methyl]-4-(8,8,9,9,10,10-hexafluoro-1,2,14-trimethyl-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-4-yl)phenol |
| SMILES | CC1=CC2=C3C(=C4C=C(c5ccc(O)c(CN(Cc6ccccn6)Cc6ccccn6)c5)SC4(C)C2(C)S1)C(F)(F)C(F)(F)C3(F)F |
| InChI | InChI=1S/C35H29F6N3OS2/c1-20-14-25-29-30(34(38,39)35(40,41)33(29,36)37)26-16-28(47-32(26,3)31(25,2)46-20)21-10-11-27(45)22(15-21)17-44(18-23-8-4-6-12-42-23)19-24-9-5-7-13-43-24/h4-16,45H,17-19H2,1-3H3 |
| InChIKey | JSXOQJZFVGIZLJ-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.76 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|