C19H24O11 — CID 122375469
[(2R,3R,4S,5S)-4-hydroxy-5-(hydroxymethyl)-2-[[(2S,3R,4R)-3,4,5-trihydroxyoxolan-2-yl]methoxy]oxolan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 122375469) has the molecular formula C19H24O11 and a molecular weight of 428.39 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-4-hydroxy-5-(hydroxymethyl)-2-[[(2S,3R,4R)-3,4,5-trihydroxyoxolan-2-yl]methoxy]oxolan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(2R,3R,4S,5S)-4-hydroxy-5-(hydroxymethyl)-2-[[(2S,3R,4R)-3,4,5-trihydroxyoxolan-2-yl]methoxy]oxolan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 122375469 |
| Molecular Formula | C19H24O11 |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | [(2R,3R,4S,5S)-4-hydroxy-5-(hydroxymethyl)-2-[[(2S,3R,4R)-3,4,5-trihydroxyoxolan-2-yl]methoxy]oxolan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(O)cc1)O[C@H]1[C@H](OC[C@@H]2OC(O)[C@H](O)[C@H]2O)O[C@@H](CO)[C@@H]1O |
| InChI | InChI=1S/C19H24O11/c20-7-11-15(24)17(30-13(22)6-3-9-1-4-10(21)5-2-9)19(29-11)27-8-12-14(23)16(25)18(26)28-12/h1-6,11-12,14-21,23-26H,7-8H2/b6-3+/t11-,12-,14-,15-,16+,17+,18?,19+/m0/s1 |
| InChIKey | KQKHZBNILQLILX-XDCAWOLPSA-N |
| XLogP | -2.15 |
| TPSA | 175.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|