C29H27BrN2O3 — CID 122376170
(3R)-3-[(3R)-3-benzyl-2-oxo-1H-indol-3-yl]-1-(4-bromo-2-tert-butylphenyl)pyrrolidine-2,5-dione (PubChem CID 122376170) has the molecular formula C29H27BrN2O3 and a molecular weight of 531.45 g/mol. Its IUPAC name is (3R)-3-[(3R)-3-benzyl-2-oxo-1H-indol-3-yl]-1-(4-bromo-2-tert-butylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[(3R)-3-benzyl-2-oxo-1H-indol-3-yl]-1-(4-bromo-2-tert-butylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 122376170 |
| Molecular Formula | C29H27BrN2O3 |
| Molecular Weight | 531.45 g/mol |
| Exact Mass | 530.12 |
| IUPAC Name | (3R)-3-[(3R)-3-benzyl-2-oxo-1H-indol-3-yl]-1-(4-bromo-2-tert-butylphenyl)pyrrolidine-2,5-dione |
| SMILES | CC(C)(C)c1cc(Br)ccc1N1C(=O)C[C@H]([C@@]2(Cc3ccccc3)C(=O)Nc3ccccc32)C1=O |
| InChI | InChI=1S/C29H27BrN2O3/c1-28(2,3)21-15-19(30)13-14-24(21)32-25(33)16-22(26(32)34)29(17-18-9-5-4-6-10-18)20-11-7-8-12-23(20)31-27(29)35/h4-15,22H,16-17H2,1-3H3,(H,31,35)/t22-,29-/m0/s1 |
| InChIKey | BYQSJVMMSSEVLA-ZTOMLWHTSA-N |
| XLogP | 5.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.45 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|