C7H15NO4 — CID 122377218
(3R,4S,5S,7R)-7-(hydroxymethyl)azepane-3,4,5-triol (PubChem CID 122377218) has the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. Its IUPAC name is (3R,4S,5S,7R)-7-(hydroxymethyl)azepane-3,4,5-triol.
| Compound Name | (3R,4S,5S,7R)-7-(hydroxymethyl)azepane-3,4,5-triol |
|---|---|
| PubChem CID | 122377218 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | (3R,4S,5S,7R)-7-(hydroxymethyl)azepane-3,4,5-triol |
| SMILES | OC[C@H]1C[C@H](O)[C@H](O)[C@H](O)CN1 |
| InChI | InChI=1S/C7H15NO4/c9-3-4-1-5(10)7(12)6(11)2-8-4/h4-12H,1-3H2/t4-,5+,6-,7+/m1/s1 |
| InChIKey | WGSDAASCMXVWGE-UCROKIRRSA-N |
| XLogP | -2.58 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |