C20H21Cl2NO3 — CID 122377512
tert-butyl N-[1,3-bis(4-chlorophenyl)-3-oxopropyl]carbamate (PubChem CID 122377512) has the molecular formula C20H21Cl2NO3 and a molecular weight of 394.30 g/mol. Its IUPAC name is tert-butyl N-[1,3-bis(4-chlorophenyl)-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[1,3-bis(4-chlorophenyl)-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 122377512 |
| Molecular Formula | C20H21Cl2NO3 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | tert-butyl N-[1,3-bis(4-chlorophenyl)-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21Cl2NO3/c1-20(2,3)26-19(25)23-17(13-4-8-15(21)9-5-13)12-18(24)14-6-10-16(22)11-7-14/h4-11,17H,12H2,1-3H3,(H,23,25) |
| InChIKey | LBDCETHRFVARKM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |