C22H17NO2 — CID 122377517
[(4S,5R)-2,4-diphenyl-4,5-dihydro-1,3-oxazol-5-yl]-phenylmethanone (PubChem CID 122377517) has the molecular formula C22H17NO2 and a molecular weight of 327.38 g/mol. Its IUPAC name is [(4S,5R)-2,4-diphenyl-4,5-dihydro-1,3-oxazol-5-yl]-phenylmethanone.
| Compound Name | [(4S,5R)-2,4-diphenyl-4,5-dihydro-1,3-oxazol-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 122377517 |
| Molecular Formula | C22H17NO2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | [(4S,5R)-2,4-diphenyl-4,5-dihydro-1,3-oxazol-5-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1OC(c2ccccc2)=N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H17NO2/c24-20(17-12-6-2-7-13-17)21-19(16-10-4-1-5-11-16)23-22(25-21)18-14-8-3-9-15-18/h1-15,19,21H/t19-,21+/m0/s1 |
| InChIKey | XSPCUHMLTNVZLW-PZJWPPBQSA-N |
| XLogP | 4.46 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |