C15H19NO5S — CID 122377958
(3aR,5R,6S,7R,7aR)-2-(4-ethoxyphenyl)-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 122377958) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is (3aR,5R,6S,7R,7aR)-2-(4-ethoxyphenyl)-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | (3aR,5R,6S,7R,7aR)-2-(4-ethoxyphenyl)-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 122377958 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (3aR,5R,6S,7R,7aR)-2-(4-ethoxyphenyl)-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | CCOc1ccc(C2=N[C@@H]3[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]3S2)cc1 |
| InChI | InChI=1S/C15H19NO5S/c1-2-20-9-5-3-8(4-6-9)14-16-11-13(19)12(18)10(7-17)21-15(11)22-14/h3-6,10-13,15,17-19H,2,7H2,1H3/t10-,11-,12-,13-,15-/m1/s1 |
| InChIKey | KXHUHBVYGFKNHI-FTQJZPFOSA-N |
| XLogP | 0.39 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |