C17H22N2O7S2 — CID 52950221
(2S,3R,4S,5R,6R)-2-[[5-[(4-ethoxyphenoxy)methyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 52950221) has the molecular formula C17H22N2O7S2 and a molecular weight of 430.50 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[[5-[(4-ethoxyphenoxy)methyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6R)-2-[[5-[(4-ethoxyphenoxy)methyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 52950221 |
| Molecular Formula | C17H22N2O7S2 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[[5-[(4-ethoxyphenoxy)methyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCOc1ccc(OCc2nnc(S[C@@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)s2)cc1 |
| InChI | InChI=1S/C17H22N2O7S2/c1-2-24-9-3-5-10(6-4-9)25-8-12-18-19-17(27-12)28-16-15(23)14(22)13(21)11(7-20)26-16/h3-6,11,13-16,20-23H,2,7-8H2,1H3/t11-,13+,14+,15-,16+/m1/s1 |
| InChIKey | WXTQPWOSMSJLPL-CHUNWDLHSA-N |
| XLogP | 0.41 |
| TPSA | 134.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |