C10H15NO5S2 — CID 146487272
(2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(1,3-thiazol-2-ylmethylsulfanyl)oxane-3,4,5-triol (PubChem CID 146487272) has the molecular formula C10H15NO5S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(1,3-thiazol-2-ylmethylsulfanyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(1,3-thiazol-2-ylmethylsulfanyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 146487272 |
| Molecular Formula | C10H15NO5S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(1,3-thiazol-2-ylmethylsulfanyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](SCc2nccs2)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H15NO5S2/c12-3-5-7(13)8(14)9(15)10(16-5)18-4-6-11-1-2-17-6/h1-2,5,7-10,12-15H,3-4H2/t5-,7+,8+,9-,10-/m1/s1 |
| InChIKey | MFFONMMXFYTDMX-MFQRKTBASA-N |
| XLogP | -0.82 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |