C15H19N3O5S — CID 72543874
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(1-phenyltriazol-4-yl)methylsulfanyl]oxane-3,4,5-triol (PubChem CID 72543874) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(1-phenyltriazol-4-yl)methylsulfanyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(1-phenyltriazol-4-yl)methylsulfanyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 72543874 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[(1-phenyltriazol-4-yl)methylsulfanyl]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](SCc2cn(-c3ccccc3)nn2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H19N3O5S/c19-7-11-12(20)13(21)14(22)15(23-11)24-8-9-6-18(17-16-9)10-4-2-1-3-5-10/h1-6,11-15,19-22H,7-8H2/t11-,12-,13+,14-,15+/m1/s1 |
| InChIKey | GTHUQTKSQDUUST-QMIVOQANSA-N |
| XLogP | -0.70 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |