C15H18IN3O5S — CID 86579610
(2S,3S,4R,5S)-2-(hydroxymethyl)-6-[(5-iodo-1-phenyltriazol-4-yl)methylsulfanyl]oxane-3,4,5-triol (PubChem CID 86579610) has the molecular formula C15H18IN3O5S and a molecular weight of 479.30 g/mol. Its IUPAC name is (2S,3S,4R,5S)-2-(hydroxymethyl)-6-[(5-iodo-1-phenyltriazol-4-yl)methylsulfanyl]oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5S)-2-(hydroxymethyl)-6-[(5-iodo-1-phenyltriazol-4-yl)methylsulfanyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 86579610 |
| Molecular Formula | C15H18IN3O5S |
| Molecular Weight | 479.30 g/mol |
| Exact Mass | 479.00 |
| IUPAC Name | (2S,3S,4R,5S)-2-(hydroxymethyl)-6-[(5-iodo-1-phenyltriazol-4-yl)methylsulfanyl]oxane-3,4,5-triol |
| SMILES | OC[C@@H]1OC(SCc2nnn(-c3ccccc3)c2I)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H18IN3O5S/c16-14-9(17-18-19(14)8-4-2-1-3-5-8)7-25-15-13(23)12(22)11(21)10(6-20)24-15/h1-5,10-13,15,20-23H,6-7H2/t10-,11+,12+,13-,15?/m0/s1 |
| InChIKey | HRLSOGQEXMJRQU-VJDSNFAGSA-N |
| XLogP | -0.09 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.30 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|