C16H20N2O6S2 — CID 46221567
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[5-[(4-methoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]sulfanyl]oxane-3,4,5-triol (PubChem CID 46221567) has the molecular formula C16H20N2O6S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[5-[(4-methoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]sulfanyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[5-[(4-methoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]sulfanyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46221567 |
| Molecular Formula | C16H20N2O6S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[5-[(4-methoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]sulfanyl]oxane-3,4,5-triol |
| SMILES | COc1ccc(Cc2nnc(S[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)s2)cc1 |
| InChI | InChI=1S/C16H20N2O6S2/c1-23-9-4-2-8(3-5-9)6-11-17-18-16(25-11)26-15-14(22)13(21)12(20)10(7-19)24-15/h2-5,10,12-15,19-22H,6-7H2,1H3/t10-,12-,13+,14-,15+/m1/s1 |
| InChIKey | WUZZVMSYSSNZRB-LFHLZQBKSA-N |
| XLogP | 0.03 |
| TPSA | 125.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |