C15H17ClN2O5S2 — CID 46221350
(2S,3R,4S,5S,6R)-2-[[5-[(3-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 46221350) has the molecular formula C15H17ClN2O5S2 and a molecular weight of 404.90 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-[[5-[(3-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-[[5-[(3-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46221350 |
| Molecular Formula | C15H17ClN2O5S2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[[5-[(3-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](Sc2nnc(Cc3cccc(Cl)c3)s2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H17ClN2O5S2/c16-8-3-1-2-7(4-8)5-10-17-18-15(24-10)25-14-13(22)12(21)11(20)9(6-19)23-14/h1-4,9,11-14,19-22H,5-6H2/t9-,11-,12+,13-,14+/m1/s1 |
| InChIKey | KMAGTRZEWHEQEX-LPUQOGTASA-N |
| XLogP | 0.67 |
| TPSA | 115.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |