C12H14Cl2O5S — CID 131854848
(2S,3R,4S,5S,6R)-2-(2,5-dichlorophenyl)sulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 131854848) has the molecular formula C12H14Cl2O5S and a molecular weight of 341.21 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-(2,5-dichlorophenyl)sulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6R)-2-(2,5-dichlorophenyl)sulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 131854848 |
| Molecular Formula | C12H14Cl2O5S |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-(2,5-dichlorophenyl)sulfanyl-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](Sc2cc(Cl)ccc2Cl)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H14Cl2O5S/c13-5-1-2-6(14)8(3-5)20-12-11(18)10(17)9(16)7(4-15)19-12/h1-3,7,9-12,15-18H,4H2/t7-,9-,10+,11-,12+/m1/s1 |
| InChIKey | KWZTZVROMUGRAB-URYVQPGZSA-N |
| XLogP | 0.89 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |