C16H18N2O4S — CID 122377964
(3aR,5R,6S,7R,7aR)-5-(hydroxymethyl)-2-(1H-indol-3-ylmethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 122377964) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is (3aR,5R,6S,7R,7aR)-5-(hydroxymethyl)-2-(1H-indol-3-ylmethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | (3aR,5R,6S,7R,7aR)-5-(hydroxymethyl)-2-(1H-indol-3-ylmethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 122377964 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (3aR,5R,6S,7R,7aR)-5-(hydroxymethyl)-2-(1H-indol-3-ylmethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | OC[C@H]1O[C@@H]2SC(Cc3c[nH]c4ccccc34)=N[C@@H]2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H18N2O4S/c19-7-11-14(20)15(21)13-16(22-11)23-12(18-13)5-8-6-17-10-4-2-1-3-9(8)10/h1-4,6,11,13-17,19-21H,5,7H2/t11-,13-,14-,15-,16-/m1/s1 |
| InChIKey | CVLWXPGQHSKERJ-JPIRQXTESA-N |
| XLogP | 0.66 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |