C29H56O3Si2 — CID 122378286
(3aS,5aR,6R,7S,9aS,9bS)-7-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,9a,9b-trimethyl-3,3a,4,5,5a,7,8,9-octahydro-2H-cyclopenta[a]naphthalen-1-one (PubChem CID 122378286) has the molecular formula C29H56O3Si2 and a molecular weight of 508.94 g/mol. Its IUPAC name is (3aS,5aR,6R,7S,9aS,9bS)-7-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,9a,9b-trimethyl-3,3a,4,5,5a,7,8,9-octahydro-2H-cyclopenta[a]naphthalen-1-one.
| Compound Name | (3aS,5aR,6R,7S,9aS,9bS)-7-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,9a,9b-trimethyl-3,3a,4,5,5a,7,8,9-octahydro-2H-cyclopenta[a]naphthalen-1-one |
|---|---|
| PubChem CID | 122378286 |
| Molecular Formula | C29H56O3Si2 |
| Molecular Weight | 508.94 g/mol |
| Exact Mass | 508.38 |
| IUPAC Name | (3aS,5aR,6R,7S,9aS,9bS)-7-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,9a,9b-trimethyl-3,3a,4,5,5a,7,8,9-octahydro-2H-cyclopenta[a]naphthalen-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@]2(C)[C@H]1CC[C@H]1CCC(=O)[C@@]12C |
| InChI | InChI=1S/C29H56O3Si2/c1-25(2,3)33(10,11)31-20-27(7)22-16-14-21-15-17-23(30)29(21,9)28(22,8)19-18-24(27)32-34(12,13)26(4,5)6/h21-22,24H,14-20H2,1-13H3/t21-,22-,24-,27-,28-,29+/m0/s1 |
| InChIKey | DXIHQBYQDVPFNE-VSWFJUNISA-N |
| XLogP | 8.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.94 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|