C10H14O3 — CID 122378529
(1R,4S,6R,7S,10R)-3-hydroxy-2-oxatricyclo[5.2.1.04,10]decane-6-carbaldehyde (PubChem CID 122378529) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (1R,4S,6R,7S,10R)-3-hydroxy-2-oxatricyclo[5.2.1.04,10]decane-6-carbaldehyde.
| Compound Name | (1R,4S,6R,7S,10R)-3-hydroxy-2-oxatricyclo[5.2.1.04,10]decane-6-carbaldehyde |
|---|---|
| PubChem CID | 122378529 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (1R,4S,6R,7S,10R)-3-hydroxy-2-oxatricyclo[5.2.1.04,10]decane-6-carbaldehyde |
| SMILES | O=C[C@@H]1C[C@@H]2C(O)O[C@@H]3CC[C@H]1[C@H]23 |
| InChI | InChI=1S/C10H14O3/c11-4-5-3-7-9-6(5)1-2-8(9)13-10(7)12/h4-10,12H,1-3H2/t5-,6+,7-,8+,9+,10?/m0/s1 |
| InChIKey | MFDIJQLNBUARHB-RARKTWBQSA-N |
| XLogP | 0.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|