C32H34Br2S2Si2 — CID 122379378
[2,2-bis[(3-bromophenyl)methylsulfanyl]-1-[dimethyl(phenyl)silyl]ethenyl]-dimethyl-phenylsilane (PubChem CID 122379378) has the molecular formula C32H34Br2S2Si2 and a molecular weight of 698.74 g/mol. Its IUPAC name is [2,2-bis[(3-bromophenyl)methylsulfanyl]-1-[dimethyl(phenyl)silyl]ethenyl]-dimethyl-phenylsilane.
| Compound Name | [2,2-bis[(3-bromophenyl)methylsulfanyl]-1-[dimethyl(phenyl)silyl]ethenyl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 122379378 |
| Molecular Formula | C32H34Br2S2Si2 |
| Molecular Weight | 698.74 g/mol |
| Exact Mass | 696.00 |
| IUPAC Name | [2,2-bis[(3-bromophenyl)methylsulfanyl]-1-[dimethyl(phenyl)silyl]ethenyl]-dimethyl-phenylsilane |
| SMILES | C[Si](C)(C(=C(SCc1cccc(Br)c1)SCc1cccc(Br)c1)[Si](C)(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H34Br2S2Si2/c1-37(2,29-17-7-5-8-18-29)32(38(3,4)30-19-9-6-10-20-30)31(35-23-25-13-11-15-27(33)21-25)36-24-26-14-12-16-28(34)22-26/h5-22H,23-24H2,1-4H3 |
| InChIKey | FKZCOYMHSNAHJS-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.74 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|